C17H25ClN2 — CID 107901764
1-[(E)-3-chloroprop-2-enyl]-2,2-diethyl-5-phenylpiperazine (PubChem CID 107901764) has the molecular formula C17H25ClN2 and a molecular weight of 292.85 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-2,2-diethyl-5-phenylpiperazine.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-2,2-diethyl-5-phenylpiperazine |
|---|---|
| PubChem CID | 107901764 |
| Molecular Formula | C17H25ClN2 |
| Molecular Weight | 292.85 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-2,2-diethyl-5-phenylpiperazine |
| SMILES | CCC1(CC)CNC(c2ccccc2)CN1C/C=C/Cl |
| InChI | InChI=1S/C17H25ClN2/c1-3-17(4-2)14-19-16(13-20(17)12-8-11-18)15-9-6-5-7-10-15/h5-11,16,19H,3-4,12-14H2,1-2H3/b11-8+ |
| InChIKey | YDCRKFWMJIFUAX-DHZHZOJOSA-N |
| XLogP | 3.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |