C14H25ClN2 — CID 114014146
1-[(E)-3-chloroprop-2-enyl]-5-cyclopropyl-2,2-diethylpiperazine (PubChem CID 114014146) has the molecular formula C14H25ClN2 and a molecular weight of 256.82 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-5-cyclopropyl-2,2-diethylpiperazine.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-5-cyclopropyl-2,2-diethylpiperazine |
|---|---|
| PubChem CID | 114014146 |
| Molecular Formula | C14H25ClN2 |
| Molecular Weight | 256.82 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-5-cyclopropyl-2,2-diethylpiperazine |
| SMILES | CCC1(CC)CNC(C2CC2)CN1C/C=C/Cl |
| InChI | InChI=1S/C14H25ClN2/c1-3-14(4-2)11-16-13(12-6-7-12)10-17(14)9-5-8-15/h5,8,12-13,16H,3-4,6-7,9-11H2,1-2H3/b8-5+ |
| InChIKey | VAYOUYFKXRCQRN-VMPITWQZSA-N |
| XLogP | 2.98 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.82 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |