C17H27N3 — CID 64860346
5-cyclopropyl-2,2-diethyl-1-(pyridin-4-ylmethyl)piperazine (PubChem CID 64860346) has the molecular formula C17H27N3 and a molecular weight of 273.42 g/mol. Its IUPAC name is 5-cyclopropyl-2,2-diethyl-1-(pyridin-4-ylmethyl)piperazine.
| Compound Name | 5-cyclopropyl-2,2-diethyl-1-(pyridin-4-ylmethyl)piperazine |
|---|---|
| PubChem CID | 64860346 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 5-cyclopropyl-2,2-diethyl-1-(pyridin-4-ylmethyl)piperazine |
| SMILES | CCC1(CC)CNC(C2CC2)CN1Cc1ccncc1 |
| InChI | InChI=1S/C17H27N3/c1-3-17(4-2)13-19-16(15-5-6-15)12-20(17)11-14-7-9-18-10-8-14/h7-10,15-16,19H,3-6,11-13H2,1-2H3 |
| InChIKey | WSCVQABQEZDBDP-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |