C14H27ClN2 — CID 107901683
1-[(E)-3-chloroprop-2-enyl]-2,2,5-triethyl-5-methylpiperazine (PubChem CID 107901683) has the molecular formula C14H27ClN2 and a molecular weight of 258.84 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-2,2,5-triethyl-5-methylpiperazine.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-2,2,5-triethyl-5-methylpiperazine |
|---|---|
| PubChem CID | 107901683 |
| Molecular Formula | C14H27ClN2 |
| Molecular Weight | 258.84 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-2,2,5-triethyl-5-methylpiperazine |
| SMILES | CCC1(C)CN(C/C=C/Cl)C(CC)(CC)CN1 |
| InChI | InChI=1S/C14H27ClN2/c1-5-13(4)12-17(10-8-9-15)14(6-2,7-3)11-16-13/h8-9,16H,5-7,10-12H2,1-4H3/b9-8+ |
| InChIKey | ICDKEZPAHBGRIG-CMDGGOBGSA-N |
| XLogP | 3.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.84 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |