C11H22F2N2 — CID 64849845
1-(2,2-difluoroethyl)-5-ethyl-2,2,5-trimethylpiperazine (PubChem CID 64849845) has the molecular formula C11H22F2N2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-5-ethyl-2,2,5-trimethylpiperazine.
| Compound Name | 1-(2,2-difluoroethyl)-5-ethyl-2,2,5-trimethylpiperazine |
|---|---|
| PubChem CID | 64849845 |
| Molecular Formula | C11H22F2N2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-(2,2-difluoroethyl)-5-ethyl-2,2,5-trimethylpiperazine |
| SMILES | CCC1(C)CN(CC(F)F)C(C)(C)CN1 |
| InChI | InChI=1S/C11H22F2N2/c1-5-11(4)8-15(6-9(12)13)10(2,3)7-14-11/h9,14H,5-8H2,1-4H3 |
| InChIKey | VIEHFZCWBKEIRX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |