About 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine
5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine (PubChem CID 64848517) has the molecular formula C16H25FN2
and a molecular weight of 264.39 g/mol. Its IUPAC name is 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine.
Molecular Properties
| Compound Name | 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine |
| PubChem CID | 64848517 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine |
| SMILES | CCC1(C)CN(Cc2ccccc2F)C(C)(C)CN1 |
| InChI | InChI=1S/C16H25FN2/c1-5-16(4)12-19(15(2,3)11-18-16)10-13-8-6-7-9-14(13)17/h6-9,18H,5,10-12H2,1-4H3 |
| InChIKey | RCLRQYZPRFCYPV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine?
The IUPAC name of 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine (CID 64848517) is 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine.
What is the SMILES notation for 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine?
The canonical SMILES for 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine is CCC1(C)CN(Cc2ccccc2F)C(C)(C)CN1.
What is the InChIKey of 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine?
The InChIKey is RCLRQYZPRFCYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25FN2/c1-5-16(4)12-19(15(2,3)11-18-16)10-13-8-6-7-9-14(13)17/h6-9,18H,5,10-12H2,1-4H3.
What are the key properties of 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine?
5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine has a molecular weight of 264.39 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-[(2-fluorophenyl)methyl]-2,2,5-trimethylpiperazine is sourced from PubChem (CID 64848517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).