C16H24Cl2N2 — CID 107310506
1-[(2,3-dichlorophenyl)methyl]-5-ethyl-2,2,5-trimethylpiperazine (PubChem CID 107310506) has the molecular formula C16H24Cl2N2 and a molecular weight of 315.29 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)methyl]-5-ethyl-2,2,5-trimethylpiperazine.
| Compound Name | 1-[(2,3-dichlorophenyl)methyl]-5-ethyl-2,2,5-trimethylpiperazine |
|---|---|
| PubChem CID | 107310506 |
| Molecular Formula | C16H24Cl2N2 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)methyl]-5-ethyl-2,2,5-trimethylpiperazine |
| SMILES | CCC1(C)CN(Cc2cccc(Cl)c2Cl)C(C)(C)CN1 |
| InChI | InChI=1S/C16H24Cl2N2/c1-5-16(4)11-20(15(2,3)10-19-16)9-12-7-6-8-13(17)14(12)18/h6-8,19H,5,9-11H2,1-4H3 |
| InChIKey | DDAFOSXDTSRCLU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |