C16H17ClN2O2 — CID 107902293
1-[(E)-3-chloroprop-2-enyl]-6-cyclopropyl-3-phenylpiperazine-2,5-dione (PubChem CID 107902293) has the molecular formula C16H17ClN2O2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 1-[(E)-3-chloroprop-2-enyl]-6-cyclopropyl-3-phenylpiperazine-2,5-dione.
| Compound Name | 1-[(E)-3-chloroprop-2-enyl]-6-cyclopropyl-3-phenylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 107902293 |
| Molecular Formula | C16H17ClN2O2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 1-[(E)-3-chloroprop-2-enyl]-6-cyclopropyl-3-phenylpiperazine-2,5-dione |
| SMILES | O=C1NC(c2ccccc2)C(=O)N(C/C=C/Cl)C1C1CC1 |
| InChI | InChI=1S/C16H17ClN2O2/c17-9-4-10-19-14(12-7-8-12)15(20)18-13(16(19)21)11-5-2-1-3-6-11/h1-6,9,12-14H,7-8,10H2,(H,18,20)/b9-4+ |
| InChIKey | IMUKAJNAIVXGBJ-RUDMXATFSA-N |
| XLogP | 2.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |