C20H12Cl2N2O7 — CID 10790249
[3-[(2,6-dichlorophenyl)methoxy]-4-hydroxy-5-nitrophenyl]-(2-nitrophenyl)methanone (PubChem CID 10790249) has the molecular formula C20H12Cl2N2O7 and a molecular weight of 463.23 g/mol. Its IUPAC name is [3-[(2,6-dichlorophenyl)methoxy]-4-hydroxy-5-nitrophenyl]-(2-nitrophenyl)methanone.
| Compound Name | [3-[(2,6-dichlorophenyl)methoxy]-4-hydroxy-5-nitrophenyl]-(2-nitrophenyl)methanone |
|---|---|
| PubChem CID | 10790249 |
| Molecular Formula | C20H12Cl2N2O7 |
| Molecular Weight | 463.23 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | [3-[(2,6-dichlorophenyl)methoxy]-4-hydroxy-5-nitrophenyl]-(2-nitrophenyl)methanone |
| SMILES | O=C(c1cc(OCc2c(Cl)cccc2Cl)c(O)c([N+](=O)[O-])c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H12Cl2N2O7/c21-14-5-3-6-15(22)13(14)10-31-18-9-11(8-17(20(18)26)24(29)30)19(25)12-4-1-2-7-16(12)23(27)28/h1-9,26H,10H2 |
| InChIKey | QNGYVOSZQDUETJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 132.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|