C11H17BrN2OS — CID 107910110
5-bromo-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pentanamide (PubChem CID 107910110) has the molecular formula C11H17BrN2OS and a molecular weight of 305.24 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pentanamide.
| Compound Name | 5-bromo-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pentanamide |
|---|---|
| PubChem CID | 107910110 |
| Molecular Formula | C11H17BrN2OS |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | 5-bromo-N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]pentanamide |
| SMILES | Cc1ncsc1CN(C)C(=O)CCCCBr |
| InChI | InChI=1S/C11H17BrN2OS/c1-9-10(16-8-13-9)7-14(2)11(15)5-3-4-6-12/h8H,3-7H2,1-2H3 |
| InChIKey | BMHKVUGUCQQEFX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|