C10H15BrN2OS — CID 107909892
5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide (PubChem CID 107909892) has the molecular formula C10H15BrN2OS and a molecular weight of 291.21 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide.
| Compound Name | 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 107909892 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide |
| SMILES | CN(Cc1cscn1)C(=O)CCCCBr |
| InChI | InChI=1S/C10H15BrN2OS/c1-13(6-9-7-15-8-12-9)10(14)4-2-3-5-11/h7-8H,2-6H2,1H3 |
| InChIKey | QTAPVWIOPGLKOB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|