About 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide
5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide (PubChem CID 107909892) has the molecular formula C10H15BrN2OS
and a molecular weight of 291.21 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide.
Molecular Properties
| Compound Name | 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide |
| PubChem CID | 107909892 |
| Molecular Formula | C10H15BrN2OS |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide |
| SMILES | CN(Cc1cscn1)C(=O)CCCCBr |
| InChI | InChI=1S/C10H15BrN2OS/c1-13(6-9-7-15-8-12-9)10(14)4-2-3-5-11/h7-8H,2-6H2,1H3 |
| InChIKey | QTAPVWIOPGLKOB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide?
The IUPAC name of 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide (CID 107909892) is 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide.
What is the SMILES notation for 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide?
The canonical SMILES for 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide is CN(Cc1cscn1)C(=O)CCCCBr.
What is the InChIKey of 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide?
The InChIKey is QTAPVWIOPGLKOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15BrN2OS/c1-13(6-9-7-15-8-12-9)10(14)4-2-3-5-11/h7-8H,2-6H2,1H3.
What are the key properties of 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide?
5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide has a molecular weight of 291.21 g/mol, XLogP of 2.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-methyl-N-(1,3-thiazol-4-ylmethyl)pentanamide is sourced from PubChem (CID 107909892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).