C11H18N2OS — CID 110679458
N-butyl-N-methyl-3-(1,3-thiazol-4-yl)propanamide (PubChem CID 110679458) has the molecular formula C11H18N2OS and a molecular weight of 226.34 g/mol. Its IUPAC name is N-butyl-N-methyl-3-(1,3-thiazol-4-yl)propanamide.
| Compound Name | N-butyl-N-methyl-3-(1,3-thiazol-4-yl)propanamide |
|---|---|
| PubChem CID | 110679458 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-butyl-N-methyl-3-(1,3-thiazol-4-yl)propanamide |
| SMILES | CCCCN(C)C(=O)CCc1cscn1 |
| InChI | InChI=1S/C11H18N2OS/c1-3-4-7-13(2)11(14)6-5-10-8-15-9-12-10/h8-9H,3-7H2,1-2H3 |
| InChIKey | GRYAITIESUONHT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |