C9H14N2O4S2 — CID 55013682
4-[methyl(1,3-thiazol-4-ylmethyl)sulfamoyl]butanoic acid (PubChem CID 55013682) has the molecular formula C9H14N2O4S2 and a molecular weight of 278.35 g/mol. Its IUPAC name is 4-[methyl(1,3-thiazol-4-ylmethyl)sulfamoyl]butanoic acid.
| Compound Name | 4-[methyl(1,3-thiazol-4-ylmethyl)sulfamoyl]butanoic acid |
|---|---|
| PubChem CID | 55013682 |
| Molecular Formula | C9H14N2O4S2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[methyl(1,3-thiazol-4-ylmethyl)sulfamoyl]butanoic acid |
| SMILES | CN(Cc1cscn1)S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C9H14N2O4S2/c1-11(5-8-6-16-7-10-8)17(14,15)4-2-3-9(12)13/h6-7H,2-5H2,1H3,(H,12,13) |
| InChIKey | OJJYOUMHURNGLL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |