C10H17N3S — CID 63841444
N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide (PubChem CID 63841444) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide.
| Compound Name | N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide |
|---|---|
| PubChem CID | 63841444 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | N-methyl-N-[(4-methyl-1,3-thiazol-5-yl)methyl]butanimidamide |
| SMILES | [H]/N=C(\CCC)N(C)Cc1scnc1C |
| InChI | InChI=1S/C10H17N3S/c1-4-5-10(11)13(3)6-9-8(2)12-7-14-9/h7,11H,4-6H2,1-3H3/b11-10+ |
| InChIKey | FXYMYNPCFKXGDN-ZHACJKMWSA-N |
| XLogP | 2.66 |
| TPSA | 39.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|