C24H19F3O6S — CID 10791291
[2-(7,8-dimethoxyphenanthren-1-yl)-5-methoxyphenyl] trifluoromethanesulfonate (PubChem CID 10791291) has the molecular formula C24H19F3O6S and a molecular weight of 492.47 g/mol. Its IUPAC name is [2-(7,8-dimethoxyphenanthren-1-yl)-5-methoxyphenyl] trifluoromethanesulfonate.
| Compound Name | [2-(7,8-dimethoxyphenanthren-1-yl)-5-methoxyphenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10791291 |
| Molecular Formula | C24H19F3O6S |
| Molecular Weight | 492.47 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | [2-(7,8-dimethoxyphenanthren-1-yl)-5-methoxyphenyl] trifluoromethanesulfonate |
| SMILES | COc1ccc(-c2cccc3c2ccc2c(OC)c(OC)ccc23)c(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C24H19F3O6S/c1-30-14-7-8-19(22(13-14)33-34(28,29)24(25,26)27)16-6-4-5-15-17(16)9-10-20-18(15)11-12-21(31-2)23(20)32-3/h4-13H,1-3H3 |
| InChIKey | RPXCYFIAZKBENL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|