C24H28O11 — CID 10791292
(2R,3R,4S,5S,6R)-2-[(1R,2S)-1,5-bis(3,4-dihydroxyphenyl)-1-methoxypent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 10791292) has the molecular formula C24H28O11 and a molecular weight of 492.48 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[(1R,2S)-1,5-bis(3,4-dihydroxyphenyl)-1-methoxypent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[(1R,2S)-1,5-bis(3,4-dihydroxyphenyl)-1-methoxypent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 10791292 |
| Molecular Formula | C24H28O11 |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[(1R,2S)-1,5-bis(3,4-dihydroxyphenyl)-1-methoxypent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CO[C@H](c1ccc(O)c(O)c1)[C@H](CC#Cc1ccc(O)c(O)c1)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H28O11/c1-33-23(13-6-8-15(27)17(29)10-13)18(4-2-3-12-5-7-14(26)16(28)9-12)34-24-22(32)21(31)20(30)19(11-25)35-24/h5-10,18-32H,4,11H2,1H3/t18-,19+,20+,21-,22+,23+,24+/m0/s1 |
| InChIKey | PFEGVXNNPUKZKH-DHLGUUOTSA-N |
| XLogP | -0.18 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|