C27H34O11 — CID 85083037
2-[1-butoxy-1,5-bis(3,4-dihydroxyphenyl)pent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 85083037) has the molecular formula C27H34O11 and a molecular weight of 534.56 g/mol. Its IUPAC name is 2-[1-butoxy-1,5-bis(3,4-dihydroxyphenyl)pent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[1-butoxy-1,5-bis(3,4-dihydroxyphenyl)pent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 85083037 |
| Molecular Formula | C27H34O11 |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 2-[1-butoxy-1,5-bis(3,4-dihydroxyphenyl)pent-4-yn-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCOC(c1ccc(O)c(O)c1)C(CC#Cc1ccc(O)c(O)c1)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C27H34O11/c1-2-3-11-36-26(16-8-10-18(30)20(32)13-16)21(6-4-5-15-7-9-17(29)19(31)12-15)37-27-25(35)24(34)23(33)22(14-28)38-27/h7-10,12-13,21-35H,2-3,6,11,14H2,1H3 |
| InChIKey | LYJSESFALKOEGB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|