C27H36O12 — CID 162842574
5-butoxy-1,5-bis(3,4-dihydroxyphenyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentan-1-one (PubChem CID 162842574) has the molecular formula C27H36O12 and a molecular weight of 552.57 g/mol. Its IUPAC name is 5-butoxy-1,5-bis(3,4-dihydroxyphenyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentan-1-one.
| Compound Name | 5-butoxy-1,5-bis(3,4-dihydroxyphenyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentan-1-one |
|---|---|
| PubChem CID | 162842574 |
| Molecular Formula | C27H36O12 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 5-butoxy-1,5-bis(3,4-dihydroxyphenyl)-4-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentan-1-one |
| SMILES | CCCCOC(c1ccc(O)c(O)c1)C(CCC(=O)c1ccc(O)c(O)c1)OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C27H36O12/c1-2-3-10-37-26(15-5-7-18(31)20(33)12-15)21(9-8-16(29)14-4-6-17(30)19(32)11-14)38-27-25(36)24(35)23(34)22(13-28)39-27/h4-7,11-12,21-28,30-36H,2-3,8-10,13H2,1H3 |
| InChIKey | UKFCOBQYWFSMKP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 206.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|