C9H7BrN2OS — CID 107915659
3-(3-bromo-4-methylphenyl)-2H-1,2,4-oxadiazole-5-thione (PubChem CID 107915659) has the molecular formula C9H7BrN2OS and a molecular weight of 271.14 g/mol. Its IUPAC name is 3-(3-bromo-4-methylphenyl)-2H-1,2,4-oxadiazole-5-thione.
| Compound Name | 3-(3-bromo-4-methylphenyl)-2H-1,2,4-oxadiazole-5-thione |
|---|---|
| PubChem CID | 107915659 |
| Molecular Formula | C9H7BrN2OS |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 269.95 |
| IUPAC Name | 3-(3-bromo-4-methylphenyl)-2H-1,2,4-oxadiazole-5-thione |
| SMILES | Cc1ccc(-c2nc(=S)o[nH]2)cc1Br |
| InChI | InChI=1S/C9H7BrN2OS/c1-5-2-3-6(4-7(5)10)8-11-9(14)13-12-8/h2-4H,1H3,(H,11,12,14) |
| InChIKey | ZFIDJLXSPWVZCX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|