C27H30O3SeSi — CID 10791784
(3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-one (PubChem CID 10791784) has the molecular formula C27H30O3SeSi and a molecular weight of 509.58 g/mol. Its IUPAC name is (3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-one.
| Compound Name | (3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-one |
|---|---|
| PubChem CID | 10791784 |
| Molecular Formula | C27H30O3SeSi |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | (3R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-phenylselanyloxolan-2-one |
| SMILES | CC(C)(C)[Si](OC[C@H]1C[C@@H]([Se]c2ccccc2)C(=O)O1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H30O3SeSi/c1-27(2,3)32(23-15-9-5-10-16-23,24-17-11-6-12-18-24)29-20-21-19-25(26(28)30-21)31-22-13-7-4-8-14-22/h4-18,21,25H,19-20H2,1-3H3/t21-,25-/m1/s1 |
| InChIKey | SXOMYUCCEVSQMK-PXDATVDWSA-N |
| XLogP | 3.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|