C23H32O3Si — CID 11014491
ethyl (4S)-4-[tert-butyl(diphenyl)silyl]oxypentanoate (PubChem CID 11014491) has the molecular formula C23H32O3Si and a molecular weight of 384.59 g/mol. Its IUPAC name is ethyl (4S)-4-[tert-butyl(diphenyl)silyl]oxypentanoate.
| Compound Name | ethyl (4S)-4-[tert-butyl(diphenyl)silyl]oxypentanoate |
|---|---|
| PubChem CID | 11014491 |
| Molecular Formula | C23H32O3Si |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | ethyl (4S)-4-[tert-butyl(diphenyl)silyl]oxypentanoate |
| SMILES | CCOC(=O)CC[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H32O3Si/c1-6-25-22(24)18-17-19(2)26-27(23(3,4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,19H,6,17-18H2,1-5H3/t19-/m0/s1 |
| InChIKey | XBBQXEFEDUBBSI-IBGZPJMESA-N |
| XLogP | 4.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|