C11H11F2N3O — CID 107919513
1-(2,2-difluoroethyl)-N'-hydroxyindole-4-carboximidamide (PubChem CID 107919513) has the molecular formula C11H11F2N3O and a molecular weight of 239.23 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N'-hydroxyindole-4-carboximidamide.
| Compound Name | 1-(2,2-difluoroethyl)-N'-hydroxyindole-4-carboximidamide |
|---|---|
| PubChem CID | 107919513 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N'-hydroxyindole-4-carboximidamide |
| SMILES | N/C(=N/O)c1cccc2c1ccn2CC(F)F |
| InChI | InChI=1S/C11H11F2N3O/c12-10(13)6-16-5-4-7-8(11(14)15-17)2-1-3-9(7)16/h1-5,10,17H,6H2,(H2,14,15) |
| InChIKey | LGPVKLRLJDNDIJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|