C14H14N4OS — CID 107919541
N'-hydroxy-1-[(2-methyl-1,3-thiazol-4-yl)methyl]indole-4-carboximidamide (PubChem CID 107919541) has the molecular formula C14H14N4OS and a molecular weight of 286.36 g/mol. Its IUPAC name is N'-hydroxy-1-[(2-methyl-1,3-thiazol-4-yl)methyl]indole-4-carboximidamide.
| Compound Name | N'-hydroxy-1-[(2-methyl-1,3-thiazol-4-yl)methyl]indole-4-carboximidamide |
|---|---|
| PubChem CID | 107919541 |
| Molecular Formula | C14H14N4OS |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | N'-hydroxy-1-[(2-methyl-1,3-thiazol-4-yl)methyl]indole-4-carboximidamide |
| SMILES | Cc1nc(Cn2ccc3c(/C(N)=N/O)cccc32)cs1 |
| InChI | InChI=1S/C14H14N4OS/c1-9-16-10(8-20-9)7-18-6-5-11-12(14(15)17-19)3-2-4-13(11)18/h2-6,8,19H,7H2,1H3,(H2,15,17) |
| InChIKey | ZKBHCEAKWXWCKH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|