C6H8F2N4O — CID 136959632
1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide (PubChem CID 136959632) has the molecular formula C6H8F2N4O and a molecular weight of 190.15 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide.
| Compound Name | 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide |
|---|---|
| PubChem CID | 136959632 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide |
| SMILES | N/C(=N\O)c1ccn(CC(F)F)n1 |
| InChI | InChI=1S/C6H8F2N4O/c7-5(8)3-12-2-1-4(10-12)6(9)11-13/h1-2,5,13H,3H2,(H2,9,11) |
| InChIKey | LWVDJNNQSXZWBX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|