About 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide
1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide (PubChem CID 136959632) has the molecular formula C6H8F2N4O
and a molecular weight of 190.15 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide |
| PubChem CID | 136959632 |
| Molecular Formula | C6H8F2N4O |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide |
| SMILES | N/C(=N\O)c1ccn(CC(F)F)n1 |
| InChI | InChI=1S/C6H8F2N4O/c7-5(8)3-12-2-1-4(10-12)6(9)11-13/h1-2,5,13H,3H2,(H2,9,11) |
| InChIKey | LWVDJNNQSXZWBX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide?
The IUPAC name of 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide (CID 136959632) is 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide.
What is the SMILES notation for 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide?
The canonical SMILES for 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide is N/C(=N\O)c1ccn(CC(F)F)n1.
What is the InChIKey of 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide?
The InChIKey is LWVDJNNQSXZWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N4O/c7-5(8)3-12-2-1-4(10-12)6(9)11-13/h1-2,5,13H,3H2,(H2,9,11).
What are the key properties of 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide?
1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide has a molecular weight of 190.15 g/mol, XLogP of 0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-N'-hydroxypyrazole-3-carboximidamide is sourced from PubChem (CID 136959632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).