C10H18F2N2O2 — CID 145001463
1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid;ethane (PubChem CID 145001463) has the molecular formula C10H18F2N2O2 and a molecular weight of 236.26 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid;ethane.
| Compound Name | 1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 145001463 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(2,2-difluoroethyl)pyrazole-3-carboxylic acid;ethane |
| SMILES | CC.CC.O=C(O)c1ccn(CC(F)F)n1 |
| InChI | InChI=1S/C6H6F2N2O2.2C2H6/c7-5(8)3-10-2-1-4(9-10)6(11)12;2*1-2/h1-2,5H,3H2,(H,11,12);2*1-2H3 |
| InChIKey | GKFLOLZCEUITRF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |