C10H16N2O3 — CID 112590103
1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrazole-3-carboxylic acid (PubChem CID 112590103) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is 1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 112590103 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-[2-[(2-methylpropan-2-yl)oxy]ethyl]pyrazole-3-carboxylic acid |
| SMILES | CC(C)(C)OCCn1ccc(C(=O)O)n1 |
| InChI | InChI=1S/C10H16N2O3/c1-10(2,3)15-7-6-12-5-4-8(11-12)9(13)14/h4-5H,6-7H2,1-3H3,(H,13,14) |
| InChIKey | RSINTQKLIWRTDD-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |