C6H7FN2O2 — CID 58356374
1-(2-fluoroethyl)pyrazole-3-carboxylic acid (PubChem CID 58356374) has the molecular formula C6H7FN2O2 and a molecular weight of 158.13 g/mol. Its IUPAC name is 1-(2-fluoroethyl)pyrazole-3-carboxylic acid.
| Compound Name | 1-(2-fluoroethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 58356374 |
| Molecular Formula | C6H7FN2O2 |
| Molecular Weight | 158.13 g/mol |
| Exact Mass | 158.05 |
| IUPAC Name | 1-(2-fluoroethyl)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(CCF)n1 |
| InChI | InChI=1S/C6H7FN2O2/c7-2-4-9-3-1-5(8-9)6(10)11/h1,3H,2,4H2,(H,10,11) |
| InChIKey | CUOWNWHOEBDREB-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.13 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |