1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid

C8H5F7N2O2 — CID 97178842

IUPAC1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid
SMILESO=C(O)c1ccn(CC(F)(F)C(F)(F)C(F)(F)F)n1
InChIInChI=1S/C8H5F7N2O2/c9-6(10,7(11,12)8(13,14)15)3-17-2-1-4(16-17)5(18)19/h1-2H,3H2,(H,18,19)
InChIKeyZEYCHWYZKFKHFJ-UHFFFAOYSA-N
MW294.13 g/mol
LogP2.41
Rot. Bonds4

About 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid

1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid (PubChem CID 97178842) has the molecular formula C8H5F7N2O2 and a molecular weight of 294.13 g/mol. Its IUPAC name is 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid.

Molecular Properties

Compound Name1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid
PubChem CID97178842
Molecular FormulaC8H5F7N2O2
Molecular Weight294.13 g/mol
Exact Mass294.02
IUPAC Name1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid
SMILESO=C(O)c1ccn(CC(F)(F)C(F)(F)C(F)(F)F)n1
InChIInChI=1S/C8H5F7N2O2/c9-6(10,7(11,12)8(13,14)15)3-17-2-1-4(16-17)5(18)19/h1-2H,3H2,(H,18,19)
InChIKeyZEYCHWYZKFKHFJ-UHFFFAOYSA-N
XLogP2.41
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.13
LogP ≤ 52.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}

Analyze 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid?
The IUPAC name of 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid (CID 97178842) is 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid.
What is the SMILES notation for 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid?
The canonical SMILES for 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid is O=C(O)c1ccn(CC(F)(F)C(F)(F)C(F)(F)F)n1.
What is the InChIKey of 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid?
The InChIKey is ZEYCHWYZKFKHFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F7N2O2/c9-6(10,7(11,12)8(13,14)15)3-17-2-1-4(16-17)5(18)19/h1-2H,3H2,(H,18,19).
What are the key properties of 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid?
1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid has a molecular weight of 294.13 g/mol, XLogP of 2.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,3,3,4,4,4-heptafluorobutyl)pyrazole-3-carboxylic acid is sourced from PubChem (CID 97178842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).