C6H4F3N2NaO2 — CID 140578642
sodium 1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylate (PubChem CID 140578642) has the molecular formula C6H4F3N2NaO2 and a molecular weight of 216.09 g/mol. Its IUPAC name is sodium 1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylate.
| Compound Name | sodium 1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 140578642 |
| Molecular Formula | C6H4F3N2NaO2 |
| Molecular Weight | 216.09 g/mol |
| Exact Mass | 216.01 |
| IUPAC Name | sodium 1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylate |
| SMILES | O=C([O-])c1ccn(CC(F)(F)F)n1.[Na+] |
| InChI | InChI=1S/C6H5F3N2O2.Na/c7-6(8,9)3-11-2-1-4(10-11)5(12)13;/h1-2H,3H2,(H,12,13);/q;+1/p-1 |
| InChIKey | KWWMKTIFCWFPLR-UHFFFAOYSA-M |
| XLogP | -3.19 |
| TPSA | 57.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.09 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |