About 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one
2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one (PubChem CID 118673377) has the molecular formula C9H11F3N2O
and a molecular weight of 220.19 g/mol. Its IUPAC name is 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one.
Molecular Properties
| Compound Name | 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one |
| PubChem CID | 118673377 |
| Molecular Formula | C9H11F3N2O |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one |
| SMILES | CC(C)C(=O)c1ccn(CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H11F3N2O/c1-6(2)8(15)7-3-4-14(13-7)5-9(10,11)12/h3-4,6H,5H2,1-2H3 |
| InChIKey | DJQKZGJLABVUPQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one?
The IUPAC name of 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one (CID 118673377) is 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one.
What is the SMILES notation for 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one?
The canonical SMILES for 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one is CC(C)C(=O)c1ccn(CC(F)(F)F)n1.
What is the InChIKey of 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one?
The InChIKey is DJQKZGJLABVUPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2O/c1-6(2)8(15)7-3-4-14(13-7)5-9(10,11)12/h3-4,6H,5H2,1-2H3.
What are the key properties of 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one?
2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one has a molecular weight of 220.19 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[1-(2,2,2-trifluoroethyl)pyrazol-3-yl]propan-1-one is sourced from PubChem (CID 118673377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).