C6H5F3N2O3 — CID 154455901
1-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid (PubChem CID 154455901) has the molecular formula C6H5F3N2O3 and a molecular weight of 210.11 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid.
| Compound Name | 1-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 154455901 |
| Molecular Formula | C6H5F3N2O3 |
| Molecular Weight | 210.11 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 1-(2,2,2-trifluoroethoxy)pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C6H5F3N2O3/c7-6(8,9)3-14-11-2-1-4(10-11)5(12)13/h1-2H,3H2,(H,12,13) |
| InChIKey | KCRLRYGGYKEOMW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.11 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |