C11H9F3N4O3 — CID 19621526
1-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]oxymethyl]pyrazole-3-carboxylic acid (PubChem CID 19621526) has the molecular formula C11H9F3N4O3 and a molecular weight of 302.21 g/mol. Its IUPAC name is 1-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]oxymethyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]oxymethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19621526 |
| Molecular Formula | C11H9F3N4O3 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-[[4-methyl-6-(trifluoromethyl)pyrimidin-2-yl]oxymethyl]pyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C(F)(F)F)nc(OCn2ccc(C(=O)O)n2)n1 |
| InChI | InChI=1S/C11H9F3N4O3/c1-6-4-8(11(12,13)14)16-10(15-6)21-5-18-3-2-7(17-18)9(19)20/h2-4H,5H2,1H3,(H,19,20) |
| InChIKey | IURSHDCEESVRBP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |