C13H18N2O2 — CID 174216005
1-non-8-ynylpyrazole-3-carboxylic acid (PubChem CID 174216005) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-non-8-ynylpyrazole-3-carboxylic acid.
| Compound Name | 1-non-8-ynylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 174216005 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-non-8-ynylpyrazole-3-carboxylic acid |
| SMILES | C#CCCCCCCCn1ccc(C(=O)O)n1 |
| InChI | InChI=1S/C13H18N2O2/c1-2-3-4-5-6-7-8-10-15-11-9-12(14-15)13(16)17/h1,9,11H,3-8,10H2,(H,16,17) |
| InChIKey | YEEJKKFOJTUVCE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|