C12H8Cl2N2 — CID 107920109
1-[(E)-2,3-dichloroprop-2-enyl]indole-5-carbonitrile (PubChem CID 107920109) has the molecular formula C12H8Cl2N2 and a molecular weight of 251.12 g/mol. Its IUPAC name is 1-[(E)-2,3-dichloroprop-2-enyl]indole-5-carbonitrile.
| Compound Name | 1-[(E)-2,3-dichloroprop-2-enyl]indole-5-carbonitrile |
|---|---|
| PubChem CID | 107920109 |
| Molecular Formula | C12H8Cl2N2 |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 1-[(E)-2,3-dichloroprop-2-enyl]indole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(ccn2C/C(Cl)=C\Cl)c1 |
| InChI | InChI=1S/C12H8Cl2N2/c13-6-11(14)8-16-4-3-10-5-9(7-15)1-2-12(10)16/h1-6H,8H2/b11-6+ |
| InChIKey | FZXKJJHHVVCHPC-IZZDOVSWSA-N |
| XLogP | 3.83 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |