C17H24N2OS — CID 107921941
3-[4-(2-methylpropyl)-5-(propylaminomethyl)-1,3-thiazol-2-yl]phenol (PubChem CID 107921941) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 3-[4-(2-methylpropyl)-5-(propylaminomethyl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 3-[4-(2-methylpropyl)-5-(propylaminomethyl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 107921941 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 3-[4-(2-methylpropyl)-5-(propylaminomethyl)-1,3-thiazol-2-yl]phenol |
| SMILES | CCCNCc1sc(-c2cccc(O)c2)nc1CC(C)C |
| InChI | InChI=1S/C17H24N2OS/c1-4-8-18-11-16-15(9-12(2)3)19-17(21-16)13-6-5-7-14(20)10-13/h5-7,10,12,18,20H,4,8-9,11H2,1-3H3 |
| InChIKey | IKGDFWSMGXYDFY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|