C16H22N2OS — CID 107921876
3-[4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]phenol (PubChem CID 107921876) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 3-[4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]phenol.
| Compound Name | 3-[4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]phenol |
|---|---|
| PubChem CID | 107921876 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 3-[4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]phenol |
| SMILES | CCCNCc1sc(-c2cccc(O)c2)nc1CCC |
| InChI | InChI=1S/C16H22N2OS/c1-3-6-14-15(11-17-9-4-2)20-16(18-14)12-7-5-8-13(19)10-12/h5,7-8,10,17,19H,3-4,6,9,11H2,1-2H3 |
| InChIKey | BZLTWZYACAWGMQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|