C16H20F2N2S — CID 114363996
N-[[2-(3,5-difluorophenyl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 114363996) has the molecular formula C16H20F2N2S and a molecular weight of 310.41 g/mol. Its IUPAC name is N-[[2-(3,5-difluorophenyl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(3,5-difluorophenyl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114363996 |
| Molecular Formula | C16H20F2N2S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[[2-(3,5-difluorophenyl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(-c2cc(F)cc(F)c2)nc1CCC |
| InChI | InChI=1S/C16H20F2N2S/c1-3-5-14-15(10-19-6-4-2)21-16(20-14)11-7-12(17)9-13(18)8-11/h7-9,19H,3-6,10H2,1-2H3 |
| InChIKey | ZYXKXSSFRMRWTL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|