C15H22N2S2 — CID 114363941
N-[[2-(4-methylthiophen-3-yl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine (PubChem CID 114363941) has the molecular formula C15H22N2S2 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-[[2-(4-methylthiophen-3-yl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-(4-methylthiophen-3-yl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 114363941 |
| Molecular Formula | C15H22N2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[[2-(4-methylthiophen-3-yl)-4-propyl-1,3-thiazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1sc(-c2cscc2C)nc1CCC |
| InChI | InChI=1S/C15H22N2S2/c1-4-6-13-14(8-16-7-5-2)19-15(17-13)12-10-18-9-11(12)3/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | JFJDRUUUYYXTOU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|