C15H15ClN2 — CID 107925396
4-chloro-2-(2,2-dimethylcyclopropyl)-6-phenylpyrimidine (PubChem CID 107925396) has the molecular formula C15H15ClN2 and a molecular weight of 258.75 g/mol. Its IUPAC name is 4-chloro-2-(2,2-dimethylcyclopropyl)-6-phenylpyrimidine.
| Compound Name | 4-chloro-2-(2,2-dimethylcyclopropyl)-6-phenylpyrimidine |
|---|---|
| PubChem CID | 107925396 |
| Molecular Formula | C15H15ClN2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 4-chloro-2-(2,2-dimethylcyclopropyl)-6-phenylpyrimidine |
| SMILES | CC1(C)CC1c1nc(Cl)cc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H15ClN2/c1-15(2)9-11(15)14-17-12(8-13(16)18-14)10-6-4-3-5-7-10/h3-8,11H,9H2,1-2H3 |
| InChIKey | UAKBNJQUBHZKTF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |