C12H12Cl2N2 — CID 143206221
2,4-dichloro-6-phenylpyrimidine;ethane (PubChem CID 143206221) has the molecular formula C12H12Cl2N2 and a molecular weight of 255.15 g/mol. Its IUPAC name is 2,4-dichloro-6-phenylpyrimidine;ethane.
| Compound Name | 2,4-dichloro-6-phenylpyrimidine;ethane |
|---|---|
| PubChem CID | 143206221 |
| Molecular Formula | C12H12Cl2N2 |
| Molecular Weight | 255.15 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2,4-dichloro-6-phenylpyrimidine;ethane |
| SMILES | CC.Clc1cc(-c2ccccc2)nc(Cl)n1 |
| InChI | InChI=1S/C10H6Cl2N2.C2H6/c11-9-6-8(13-10(12)14-9)7-4-2-1-3-5-7;1-2/h1-6H;1-2H3 |
| InChIKey | BLIGVOOGGYQTCS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.15 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |