C13H13F2N3S2 — CID 107935034
2,3-difluoro-4-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide (PubChem CID 107935034) has the molecular formula C13H13F2N3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2,3-difluoro-4-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107935034 |
| Molecular Formula | C13H13F2N3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2,3-difluoro-4-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide |
| SMILES | Cc1csc(C(C)Nc2ccc(C(N)=S)c(F)c2F)n1 |
| InChI | InChI=1S/C13H13F2N3S2/c1-6-5-20-13(17-6)7(2)18-9-4-3-8(12(16)19)10(14)11(9)15/h3-5,7,18H,1-2H3,(H2,16,19) |
| InChIKey | IRFAZZYXZXOXIM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|