C13H14BrN3S2 — CID 82805043
3-bromo-4-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide (PubChem CID 82805043) has the molecular formula C13H14BrN3S2 and a molecular weight of 356.31 g/mol. Its IUPAC name is 3-bromo-4-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 82805043 |
| Molecular Formula | C13H14BrN3S2 |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | 3-bromo-4-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]benzenecarbothioamide |
| SMILES | Cc1csc(C(C)Nc2ccc(C(N)=S)cc2Br)n1 |
| InChI | InChI=1S/C13H14BrN3S2/c1-7-6-19-13(16-7)8(2)17-11-4-3-9(12(15)18)5-10(11)14/h3-6,8,17H,1-2H3,(H2,15,18) |
| InChIKey | MMJGGWMZMQUKQB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|