C15H18BrClN2O — CID 107940061
(3-bromo-5-chlorophenyl)-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone (PubChem CID 107940061) has the molecular formula C15H18BrClN2O and a molecular weight of 357.68 g/mol. Its IUPAC name is (3-bromo-5-chlorophenyl)-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone.
| Compound Name | (3-bromo-5-chlorophenyl)-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
|---|---|
| PubChem CID | 107940061 |
| Molecular Formula | C15H18BrClN2O |
| Molecular Weight | 357.68 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | (3-bromo-5-chlorophenyl)-(4,4-dimethyl-1,2,3,3a,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methanone |
| SMILES | CC1(C)C2CNCC2CN1C(=O)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C15H18BrClN2O/c1-15(2)13-7-18-6-10(13)8-19(15)14(20)9-3-11(16)5-12(17)4-9/h3-5,10,13,18H,6-8H2,1-2H3 |
| InChIKey | GWWOGBVCBOSPDB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.68 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |