C38H49NO5Si — CID 10794035
(4R,5S)-3-[(E,3R,11S)-11-[tert-butyl(diphenyl)silyl]oxy-3-hydroxydodec-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 10794035) has the molecular formula C38H49NO5Si and a molecular weight of 627.90 g/mol. Its IUPAC name is (4R,5S)-3-[(E,3R,11S)-11-[tert-butyl(diphenyl)silyl]oxy-3-hydroxydodec-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(E,3R,11S)-11-[tert-butyl(diphenyl)silyl]oxy-3-hydroxydodec-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10794035 |
| Molecular Formula | C38H49NO5Si |
| Molecular Weight | 627.90 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | (4R,5S)-3-[(E,3R,11S)-11-[tert-butyl(diphenyl)silyl]oxy-3-hydroxydodec-6-enoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@@H]1[C@H](c2ccccc2)OC(=O)N1C(=O)C[C@H](O)CC/C=C/CCC[C@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C38H49NO5Si/c1-29(44-45(38(3,4)5,33-24-16-10-17-25-33)34-26-18-11-19-27-34)20-12-7-6-8-15-23-32(40)28-35(41)39-30(2)36(43-37(39)42)31-21-13-9-14-22-31/h6,8-11,13-14,16-19,21-22,24-27,29-30,32,36,40H,7,12,15,20,23,28H2,1-5H3/b8-6+/t29-,30+,32+,36+/m0/s1 |
| InChIKey | PPSMRRMBUGOZBF-CSNGMIQESA-N |
| XLogP | 7.32 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.90 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|