C33H46N6O7 — CID 10794174
tert-butyl 2-[(3R,6R,9S,12R,15S)-6-(1H-indol-3-ylmethyl)-12-methyl-9-(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetate (PubChem CID 10794174) has the molecular formula C33H46N6O7 and a molecular weight of 638.77 g/mol. Its IUPAC name is tert-butyl 2-[(3R,6R,9S,12R,15S)-6-(1H-indol-3-ylmethyl)-12-methyl-9-(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,6R,9S,12R,15S)-6-(1H-indol-3-ylmethyl)-12-methyl-9-(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetate |
|---|---|
| PubChem CID | 10794174 |
| Molecular Formula | C33H46N6O7 |
| Molecular Weight | 638.77 g/mol |
| Exact Mass | 638.34 |
| IUPAC Name | tert-butyl 2-[(3R,6R,9S,12R,15S)-6-(1H-indol-3-ylmethyl)-12-methyl-9-(2-methylpropyl)-2,5,8,11,14-pentaoxo-1,4,7,10,13-pentazabicyclo[13.3.0]octadecan-3-yl]acetate |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@@H](C)NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(=O)OC(C)(C)C)NC(=O)[C@@H](Cc2c[nH]c3ccccc23)NC1=O |
| InChI | InChI=1S/C33H46N6O7/c1-18(2)14-23-29(42)37-24(15-20-17-34-22-11-8-7-10-21(20)22)30(43)38-25(16-27(40)46-33(4,5)6)32(45)39-13-9-12-26(39)31(44)35-19(3)28(41)36-23/h7-8,10-11,17-19,23-26,34H,9,12-16H2,1-6H3,(H,35,44)(H,36,41)(H,37,42)(H,38,43)/t19-,23+,24-,25-,26+/m1/s1 |
| InChIKey | MMFIQLHQJYAYQO-XWUDYLRQSA-N |
| XLogP | 1.45 |
| TPSA | 178.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.77 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |