C11H20N2O2 — CID 107943979
N-[[5-(propoxymethyl)-1,3-oxazol-4-yl]methyl]propan-2-amine (PubChem CID 107943979) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is N-[[5-(propoxymethyl)-1,3-oxazol-4-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(propoxymethyl)-1,3-oxazol-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 107943979 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | N-[[5-(propoxymethyl)-1,3-oxazol-4-yl]methyl]propan-2-amine |
| SMILES | CCCOCc1ocnc1CNC(C)C |
| InChI | InChI=1S/C11H20N2O2/c1-4-5-14-7-11-10(13-8-15-11)6-12-9(2)3/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | KNEHHISHGZYDDT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|