C17H23BrClN — CID 107947128
N-[(3-bromo-5-chlorophenyl)-(cyclohepten-1-yl)methyl]propan-1-amine (PubChem CID 107947128) has the molecular formula C17H23BrClN and a molecular weight of 356.74 g/mol. Its IUPAC name is N-[(3-bromo-5-chlorophenyl)-(cyclohepten-1-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-5-chlorophenyl)-(cyclohepten-1-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 107947128 |
| Molecular Formula | C17H23BrClN |
| Molecular Weight | 356.74 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-[(3-bromo-5-chlorophenyl)-(cyclohepten-1-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCCCC1)c1cc(Cl)cc(Br)c1 |
| InChI | InChI=1S/C17H23BrClN/c1-2-9-20-17(13-7-5-3-4-6-8-13)14-10-15(18)12-16(19)11-14/h7,10-12,17,20H,2-6,8-9H2,1H3 |
| InChIKey | SAQIAUIBPOMHEL-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.74 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|