C18H25BrFN — CID 106653510
N-[(3-bromo-5-fluorophenyl)-[(1E)-cycloocten-1-yl]methyl]propan-1-amine (PubChem CID 106653510) has the molecular formula C18H25BrFN and a molecular weight of 354.31 g/mol. Its IUPAC name is N-[(3-bromo-5-fluorophenyl)-[(1E)-cycloocten-1-yl]methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-5-fluorophenyl)-[(1E)-cycloocten-1-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 106653510 |
| Molecular Formula | C18H25BrFN |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | N-[(3-bromo-5-fluorophenyl)-[(1E)-cycloocten-1-yl]methyl]propan-1-amine |
| SMILES | CCCNC(/C1=C/CCCCCC1)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C18H25BrFN/c1-2-10-21-18(14-8-6-4-3-5-7-9-14)15-11-16(19)13-17(20)12-15/h8,11-13,18,21H,2-7,9-10H2,1H3/b14-8+ |
| InChIKey | ZHYJJOFNLLTPDK-RIYZIHGNSA-N |
| XLogP | 5.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|