C15H19BrFN — CID 63505014
N-[(3-bromo-5-fluorophenyl)-(cyclopenten-1-yl)methyl]propan-1-amine (PubChem CID 63505014) has the molecular formula C15H19BrFN and a molecular weight of 312.23 g/mol. Its IUPAC name is N-[(3-bromo-5-fluorophenyl)-(cyclopenten-1-yl)methyl]propan-1-amine.
| Compound Name | N-[(3-bromo-5-fluorophenyl)-(cyclopenten-1-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63505014 |
| Molecular Formula | C15H19BrFN |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-[(3-bromo-5-fluorophenyl)-(cyclopenten-1-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCC1)c1cc(F)cc(Br)c1 |
| InChI | InChI=1S/C15H19BrFN/c1-2-7-18-15(11-5-3-4-6-11)12-8-13(16)10-14(17)9-12/h5,8-10,15,18H,2-4,6-7H2,1H3 |
| InChIKey | SLZMQSPXMNUJME-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|