About 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid
2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (PubChem CID 107949317) has the molecular formula C11H8Br2N2O3S2
and a molecular weight of 440.14 g/mol. Its IUPAC name is 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 107949317 |
| Molecular Formula | C11H8Br2N2O3S2 |
| Molecular Weight | 440.14 g/mol |
| Exact Mass | 437.83 |
| IUPAC Name | 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(NC(=O)c1cc(Br)sc1Br)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C11H8Br2N2O3S2/c1-4(10-15-6(3-19-10)11(17)18)14-9(16)5-2-7(12)20-8(5)13/h2-4H,1H3,(H,14,16)(H,17,18) |
| InChIKey | FXTLORLDJOSMSN-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.14 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid (CID 107949317) is 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid is CC(NC(=O)c1cc(Br)sc1Br)c1nc(C(=O)O)cs1.
What is the InChIKey of 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid?
The InChIKey is FXTLORLDJOSMSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8Br2N2O3S2/c1-4(10-15-6(3-19-10)11(17)18)14-9(16)5-2-7(12)20-8(5)13/h2-4H,1H3,(H,14,16)(H,17,18).
What are the key properties of 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid?
2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid has a molecular weight of 440.14 g/mol, XLogP of 3.92, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2,5-dibromothiophene-3-carbonyl)amino]ethyl]-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 107949317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).